C29H47N5O5S — CID 170632393
N-[1-cyano-2-(6,6-dimethyl-2-oxo-1,5,7,8-tetrahydroquinolin-3-yl)ethyl]formamide;1-[(5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethylbutan-1-one;methanesulfonamide (PubChem CID 170632393) has the molecular formula C29H47N5O5S and a molecular weight of 577.79 g/mol. Its IUPAC name is N-[1-cyano-2-(6,6-dimethyl-2-oxo-1,5,7,8-tetrahydroquinolin-3-yl)ethyl]formamide;1-[(5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethylbutan-1-one;methanesulfonamide.
| Compound Name | N-[1-cyano-2-(6,6-dimethyl-2-oxo-1,5,7,8-tetrahydroquinolin-3-yl)ethyl]formamide;1-[(5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethylbutan-1-one;methanesulfonamide |
|---|---|
| PubChem CID | 170632393 |
| Molecular Formula | C29H47N5O5S |
| Molecular Weight | 577.79 g/mol |
| Exact Mass | 577.33 |
| IUPAC Name | N-[1-cyano-2-(6,6-dimethyl-2-oxo-1,5,7,8-tetrahydroquinolin-3-yl)ethyl]formamide;1-[(5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-3,3-dimethylbutan-1-one;methanesulfonamide |
| SMILES | CC(C)(C)CC(=O)N1CC2[C@H](C1)C2(C)C.CC1(C)CCc2[nH]c(=O)c(CC(C#N)NC=O)cc2C1.CS(N)(=O)=O |
| InChI | InChI=1S/C15H19N3O2.C13H23NO.CH5NO2S/c1-15(2)4-3-13-11(7-15)5-10(14(20)18-13)6-12(8-16)17-9-19;1-12(2,3)6-11(15)14-7-9-10(8-14)13(9,4)5;1-5(2,3)4/h5,9,12H,3-4,6-7H2,1-2H3,(H,17,19)(H,18,20);9-10H,6-8H2,1-5H3;1H3,(H2,2,3,4)/t;9-,10?;/m.0./s1 |
| InChIKey | OLSFROCIMCLKES-KDDYDKPPSA-N |
| XLogP | 2.51 |
| TPSA | 166.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.79 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|