C15H29NO3 — CID 170632402
1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3,3-dimethylbutan-1-one;formic acid;methane (PubChem CID 170632402) has the molecular formula C15H29NO3 and a molecular weight of 271.40 g/mol. Its IUPAC name is 1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3,3-dimethylbutan-1-one;formic acid;methane.
| Compound Name | 1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3,3-dimethylbutan-1-one;formic acid;methane |
|---|---|
| PubChem CID | 170632402 |
| Molecular Formula | C15H29NO3 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | 1-(6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl)-3,3-dimethylbutan-1-one;formic acid;methane |
| SMILES | C.CC(C)(C)CC(=O)N1CC2C(C1)C2(C)C.O=CO |
| InChI | InChI=1S/C13H23NO.CH2O2.CH4/c1-12(2,3)6-11(15)14-7-9-10(8-14)13(9,4)5;2-1-3;/h9-10H,6-8H2,1-5H3;1H,(H,2,3);1H4 |
| InChIKey | DRVYBOKOBRQCBJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|