About N-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-thiazol-2-amine;molecular hydrogen;propane
N-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-thiazol-2-amine;molecular hydrogen;propane (PubChem CID 170632496) has the molecular formula C13H28N2S
and a molecular weight of 244.45 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-thiazol-2-amine;molecular hydrogen;propane.
Molecular Properties
| Compound Name | N-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-thiazol-2-amine;molecular hydrogen;propane |
| PubChem CID | 170632496 |
| Molecular Formula | C13H28N2S |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-thiazol-2-amine;molecular hydrogen;propane |
| SMILES | CCC.Cc1cnc(NC(C)C(C)(C)C)s1.[H][H] |
| InChI | InChI=1S/C10H18N2S.C3H8.H2/c1-7-6-11-9(13-7)12-8(2)10(3,4)5;1-3-2;/h6,8H,1-5H3,(H,11,12);3H2,1-2H3;1H |
| InChIKey | SKOUUNMTTZEXDR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-thiazol-2-amine;molecular hydrogen;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-thiazol-2-amine;molecular hydrogen;propane?
The IUPAC name of N-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-thiazol-2-amine;molecular hydrogen;propane (CID 170632496) is N-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-thiazol-2-amine;molecular hydrogen;propane.
What is the SMILES notation for N-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-thiazol-2-amine;molecular hydrogen;propane?
The canonical SMILES for N-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-thiazol-2-amine;molecular hydrogen;propane is CCC.Cc1cnc(NC(C)C(C)(C)C)s1.[H][H].
What is the InChIKey of N-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-thiazol-2-amine;molecular hydrogen;propane?
The InChIKey is SKOUUNMTTZEXDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2S.C3H8.H2/c1-7-6-11-9(13-7)12-8(2)10(3,4)5;1-3-2;/h6,8H,1-5H3,(H,11,12);3H2,1-2H3;1H.
What are the key properties of N-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-thiazol-2-amine;molecular hydrogen;propane?
N-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-thiazol-2-amine;molecular hydrogen;propane has a molecular weight of 244.45 g/mol, XLogP of 4.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-dimethylbutan-2-yl)-5-methyl-1,3-thiazol-2-amine;molecular hydrogen;propane is sourced from PubChem (CID 170632496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).