C30H36FNO — CID 170633550
(8R,9S,10S,13S,14S)-3-(3-fluoro-2-pyridin-2-ylphenyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 170633550) has the molecular formula C30H36FNO and a molecular weight of 445.62 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S)-3-(3-fluoro-2-pyridin-2-ylphenyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,10S,13S,14S)-3-(3-fluoro-2-pyridin-2-ylphenyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 170633550 |
| Molecular Formula | C30H36FNO |
| Molecular Weight | 445.62 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | (8R,9S,10S,13S,14S)-3-(3-fluoro-2-pyridin-2-ylphenyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCC(c3cccc(F)c3-c3ccccn3)CC1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C30H36FNO/c1-29-15-13-19(21-6-5-7-25(31)28(21)26-8-3-4-17-32-26)18-20(29)9-10-22-23-11-12-27(33)30(23,2)16-14-24(22)29/h3-8,17,19-20,22-24H,9-16,18H2,1-2H3/t19?,20?,22-,23-,24-,29-,30-/m0/s1 |
| InChIKey | GZXZEZPFNRAQCT-GNOUGRTCSA-N |
| XLogP | 7.58 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.62 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |