About acetylene;5-methyl-4-methylsulfanyl-1-propan-2-yl-3,6-dihydro-2H-pyridine
acetylene;5-methyl-4-methylsulfanyl-1-propan-2-yl-3,6-dihydro-2H-pyridine (PubChem CID 170633791) has the molecular formula C12H21NS
and a molecular weight of 211.37 g/mol. Its IUPAC name is acetylene;5-methyl-4-methylsulfanyl-1-propan-2-yl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | acetylene;5-methyl-4-methylsulfanyl-1-propan-2-yl-3,6-dihydro-2H-pyridine |
| PubChem CID | 170633791 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | acetylene;5-methyl-4-methylsulfanyl-1-propan-2-yl-3,6-dihydro-2H-pyridine |
| SMILES | C#C.CSC1=C(C)CN(C(C)C)CC1 |
| InChI | InChI=1S/C10H19NS.C2H2/c1-8(2)11-6-5-10(12-4)9(3)7-11;1-2/h8H,5-7H2,1-4H3;1-2H |
| InChIKey | KSBNMBAVZRMAGD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;5-methyl-4-methylsulfanyl-1-propan-2-yl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;5-methyl-4-methylsulfanyl-1-propan-2-yl-3,6-dihydro-2H-pyridine?
The IUPAC name of acetylene;5-methyl-4-methylsulfanyl-1-propan-2-yl-3,6-dihydro-2H-pyridine (CID 170633791) is acetylene;5-methyl-4-methylsulfanyl-1-propan-2-yl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for acetylene;5-methyl-4-methylsulfanyl-1-propan-2-yl-3,6-dihydro-2H-pyridine?
The canonical SMILES for acetylene;5-methyl-4-methylsulfanyl-1-propan-2-yl-3,6-dihydro-2H-pyridine is C#C.CSC1=C(C)CN(C(C)C)CC1.
What is the InChIKey of acetylene;5-methyl-4-methylsulfanyl-1-propan-2-yl-3,6-dihydro-2H-pyridine?
The InChIKey is KSBNMBAVZRMAGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NS.C2H2/c1-8(2)11-6-5-10(12-4)9(3)7-11;1-2/h8H,5-7H2,1-4H3;1-2H.
What are the key properties of acetylene;5-methyl-4-methylsulfanyl-1-propan-2-yl-3,6-dihydro-2H-pyridine?
acetylene;5-methyl-4-methylsulfanyl-1-propan-2-yl-3,6-dihydro-2H-pyridine has a molecular weight of 211.37 g/mol, XLogP of 2.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;5-methyl-4-methylsulfanyl-1-propan-2-yl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 170633791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).