C36H43N5O2 — CID 170633890
N-[5-[3-(2,2-dimethylpyrrolidin-1-yl)propanoylamino]-2-methyl-3-pyridinyl]-2-[5-(3-ethyl-2-methanimidoylphenyl)spiro[2.6]nona-1,4,6-trien-9-yl]prop-2-enamide (PubChem CID 170633890) has the molecular formula C36H43N5O2 and a molecular weight of 577.77 g/mol. Its IUPAC name is N-[5-[3-(2,2-dimethylpyrrolidin-1-yl)propanoylamino]-2-methyl-3-pyridinyl]-2-[5-(3-ethyl-2-methanimidoylphenyl)spiro[2.6]nona-1,4,6-trien-9-yl]prop-2-enamide.
| Compound Name | N-[5-[3-(2,2-dimethylpyrrolidin-1-yl)propanoylamino]-2-methyl-3-pyridinyl]-2-[5-(3-ethyl-2-methanimidoylphenyl)spiro[2.6]nona-1,4,6-trien-9-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170633890 |
| Molecular Formula | C36H43N5O2 |
| Molecular Weight | 577.77 g/mol |
| Exact Mass | 577.34 |
| IUPAC Name | N-[5-[3-(2,2-dimethylpyrrolidin-1-yl)propanoylamino]-2-methyl-3-pyridinyl]-2-[5-(3-ethyl-2-methanimidoylphenyl)spiro[2.6]nona-1,4,6-trien-9-yl]prop-2-enamide |
| SMILES | [H]/N=C/c1c(CC)cccc1C1=CC2(C=C2)C(C(=C)C(=O)Nc2cc(NC(=O)CCN3CCCC3(C)C)cnc2C)CC=C1 |
| InChI | InChI=1S/C36H43N5O2/c1-6-26-10-7-12-29(30(26)22-37)27-11-8-13-31(36(21-27)16-17-36)24(2)34(43)40-32-20-28(23-38-25(32)3)39-33(42)14-19-41-18-9-15-35(41,4)5/h7-8,10-12,16-17,20-23,31,37H,2,6,9,13-15,18-19H2,1,3-5H3,(H,39,42)(H,40,43)/b37-22+ |
| InChIKey | NORWMNGOHVXPIP-SEBMTOOBSA-N |
| XLogP | 6.86 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.77 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|