C30H38N8O3 — CID 170634315
4-(2,2-dimethylcyclopentyl)-N-[5-[[(2E)-2-hydrazinylidene-2-[5-[1-(oxetan-3-yl)pyrazol-3-yl]-2-pyridinyl]acetyl]amino]-6-methyl-3-pyridinyl]butanamide (PubChem CID 170634315) has the molecular formula C30H38N8O3 and a molecular weight of 558.69 g/mol. Its IUPAC name is 4-(2,2-dimethylcyclopentyl)-N-[5-[[(2E)-2-hydrazinylidene-2-[5-[1-(oxetan-3-yl)pyrazol-3-yl]-2-pyridinyl]acetyl]amino]-6-methyl-3-pyridinyl]butanamide.
| Compound Name | 4-(2,2-dimethylcyclopentyl)-N-[5-[[(2E)-2-hydrazinylidene-2-[5-[1-(oxetan-3-yl)pyrazol-3-yl]-2-pyridinyl]acetyl]amino]-6-methyl-3-pyridinyl]butanamide |
|---|---|
| PubChem CID | 170634315 |
| Molecular Formula | C30H38N8O3 |
| Molecular Weight | 558.69 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | 4-(2,2-dimethylcyclopentyl)-N-[5-[[(2E)-2-hydrazinylidene-2-[5-[1-(oxetan-3-yl)pyrazol-3-yl]-2-pyridinyl]acetyl]amino]-6-methyl-3-pyridinyl]butanamide |
| SMILES | Cc1ncc(NC(=O)CCCC2CCCC2(C)C)cc1NC(=O)/C(=N/N)c1ccc(-c2ccn(C3COC3)n2)cn1 |
| InChI | InChI=1S/C30H38N8O3/c1-19-26(14-22(16-32-19)34-27(39)8-4-6-21-7-5-12-30(21,2)3)35-29(40)28(36-31)25-10-9-20(15-33-25)24-11-13-38(37-24)23-17-41-18-23/h9-11,13-16,21,23H,4-8,12,17-18,31H2,1-3H3,(H,34,39)(H,35,40)/b36-28+ |
| InChIKey | RPDGMEKIURZHPY-FDEZRRJOSA-N |
| XLogP | 4.46 |
| TPSA | 149.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.69 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|