C14H13N3O2 — CID 170635404
6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyrazolo[1,5-a]pyrazine-3-carboxylic acid (PubChem CID 170635404) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyrazolo[1,5-a]pyrazine-3-carboxylic acid.
| Compound Name | 6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyrazolo[1,5-a]pyrazine-3-carboxylic acid |
|---|---|
| PubChem CID | 170635404 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]pyrazolo[1,5-a]pyrazine-3-carboxylic acid |
| SMILES | C=C/C=C(\C=C/C)c1cn2ncc(C(=O)O)c2cn1 |
| InChI | InChI=1S/C14H13N3O2/c1-3-5-10(6-4-2)12-9-17-13(8-15-12)11(7-16-17)14(18)19/h3-9H,1H2,2H3,(H,18,19)/b6-4-,10-5+ |
| InChIKey | JHAHMWIGKXXHJU-KNVSICBPSA-N |
| XLogP | 2.57 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|