C20H26BN3O3 — CID 170635766
5-benzyl-7-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,7-dihydropyrazolo[1,5-a]pyrazin-6-one (PubChem CID 170635766) has the molecular formula C20H26BN3O3 and a molecular weight of 367.26 g/mol. Its IUPAC name is 5-benzyl-7-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,7-dihydropyrazolo[1,5-a]pyrazin-6-one.
| Compound Name | 5-benzyl-7-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,7-dihydropyrazolo[1,5-a]pyrazin-6-one |
|---|---|
| PubChem CID | 170635766 |
| Molecular Formula | C20H26BN3O3 |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 5-benzyl-7-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,7-dihydropyrazolo[1,5-a]pyrazin-6-one |
| SMILES | CC1C(=O)N(Cc2ccccc2)Cc2c(B3OC(C)(C)C(C)(C)O3)cnn21 |
| InChI | InChI=1S/C20H26BN3O3/c1-14-18(25)23(12-15-9-7-6-8-10-15)13-17-16(11-22-24(14)17)21-26-19(2,3)20(4,5)27-21/h6-11,14H,12-13H2,1-5H3 |
| InChIKey | INTWLAUKMSBNNQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|