About N-ethyl-N-[(3-methoxybenzene-4-id-1-yl)methyl]ethanamine;holmium
N-ethyl-N-[(3-methoxybenzene-4-id-1-yl)methyl]ethanamine;holmium (PubChem CID 170636177) has the molecular formula C12H18HoNO-
and a molecular weight of 357.21 g/mol. Its IUPAC name is N-ethyl-N-[(3-methoxybenzene-4-id-1-yl)methyl]ethanamine;holmium.
Molecular Properties
| Compound Name | N-ethyl-N-[(3-methoxybenzene-4-id-1-yl)methyl]ethanamine;holmium |
| PubChem CID | 170636177 |
| Molecular Formula | C12H18HoNO- |
| Molecular Weight | 357.21 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | N-ethyl-N-[(3-methoxybenzene-4-id-1-yl)methyl]ethanamine;holmium |
| SMILES | CCN(CC)Cc1cc[c-]c(OC)c1.[Ho] |
| InChI | InChI=1S/C12H18NO.Ho/c1-4-13(5-2)10-11-7-6-8-12(9-11)14-3;/h6-7,9H,4-5,10H2,1-3H3;/q-1; |
| InChIKey | CTKDPEMDGDPYEV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-[(3-methoxybenzene-4-id-1-yl)methyl]ethanamine;holmium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-[(3-methoxybenzene-4-id-1-yl)methyl]ethanamine;holmium?
The IUPAC name of N-ethyl-N-[(3-methoxybenzene-4-id-1-yl)methyl]ethanamine;holmium (CID 170636177) is N-ethyl-N-[(3-methoxybenzene-4-id-1-yl)methyl]ethanamine;holmium.
What is the SMILES notation for N-ethyl-N-[(3-methoxybenzene-4-id-1-yl)methyl]ethanamine;holmium?
The canonical SMILES for N-ethyl-N-[(3-methoxybenzene-4-id-1-yl)methyl]ethanamine;holmium is CCN(CC)Cc1cc[c-]c(OC)c1.[Ho].
What is the InChIKey of N-ethyl-N-[(3-methoxybenzene-4-id-1-yl)methyl]ethanamine;holmium?
The InChIKey is CTKDPEMDGDPYEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18NO.Ho/c1-4-13(5-2)10-11-7-6-8-12(9-11)14-3;/h6-7,9H,4-5,10H2,1-3H3;/q-1;.
What are the key properties of N-ethyl-N-[(3-methoxybenzene-4-id-1-yl)methyl]ethanamine;holmium?
N-ethyl-N-[(3-methoxybenzene-4-id-1-yl)methyl]ethanamine;holmium has a molecular weight of 357.21 g/mol, XLogP of 2.34, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-[(3-methoxybenzene-4-id-1-yl)methyl]ethanamine;holmium is sourced from PubChem (CID 170636177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).