C20H26F3N5O2 — CID 170636272
[3-(2,3-dihydro-1H-1,2,4-triazol-5-yl)pyrrolidin-1-yl]-[3-[4-(1,1,1-trifluoro-2-methylpropan-2-yl)oxyphenyl]azetidin-1-yl]methanone (PubChem CID 170636272) has the molecular formula C20H26F3N5O2 and a molecular weight of 425.46 g/mol. Its IUPAC name is [3-(2,3-dihydro-1H-1,2,4-triazol-5-yl)pyrrolidin-1-yl]-[3-[4-(1,1,1-trifluoro-2-methylpropan-2-yl)oxyphenyl]azetidin-1-yl]methanone.
| Compound Name | [3-(2,3-dihydro-1H-1,2,4-triazol-5-yl)pyrrolidin-1-yl]-[3-[4-(1,1,1-trifluoro-2-methylpropan-2-yl)oxyphenyl]azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 170636272 |
| Molecular Formula | C20H26F3N5O2 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | [3-(2,3-dihydro-1H-1,2,4-triazol-5-yl)pyrrolidin-1-yl]-[3-[4-(1,1,1-trifluoro-2-methylpropan-2-yl)oxyphenyl]azetidin-1-yl]methanone |
| SMILES | CC(C)(Oc1ccc(C2CN(C(=O)N3CCC(C4=NCNN4)C3)C2)cc1)C(F)(F)F |
| InChI | InChI=1S/C20H26F3N5O2/c1-19(2,20(21,22)23)30-16-5-3-13(4-6-16)15-10-28(11-15)18(29)27-8-7-14(9-27)17-24-12-25-26-17/h3-6,14-15,25H,7-12H2,1-2H3,(H,24,26) |
| InChIKey | FNLJKOIIOBQFOR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |