C21H26FN5O — CID 170636410
[3-[4-(3-fluoropyrrolidin-1-yl)phenyl]azetidin-1-yl]-[(3S)-3-(1H-pyrazol-5-yl)pyrrolidin-1-yl]methanone (PubChem CID 170636410) has the molecular formula C21H26FN5O and a molecular weight of 383.47 g/mol. Its IUPAC name is [3-[4-(3-fluoropyrrolidin-1-yl)phenyl]azetidin-1-yl]-[(3S)-3-(1H-pyrazol-5-yl)pyrrolidin-1-yl]methanone.
| Compound Name | [3-[4-(3-fluoropyrrolidin-1-yl)phenyl]azetidin-1-yl]-[(3S)-3-(1H-pyrazol-5-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 170636410 |
| Molecular Formula | C21H26FN5O |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | [3-[4-(3-fluoropyrrolidin-1-yl)phenyl]azetidin-1-yl]-[(3S)-3-(1H-pyrazol-5-yl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(N1CC(c2ccc(N3CCC(F)C3)cc2)C1)N1CC[C@H](c2ccn[nH]2)C1 |
| InChI | InChI=1S/C21H26FN5O/c22-18-7-10-25(14-18)19-3-1-15(2-4-19)17-12-27(13-17)21(28)26-9-6-16(11-26)20-5-8-23-24-20/h1-5,8,16-18H,6-7,9-14H2,(H,23,24)/t16-,18?/m0/s1 |
| InChIKey | PEUDURWCOIMCJJ-ATNAJCNCSA-N |
| XLogP | 2.97 |
| TPSA | 55.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|