C17H11F3N4O4 — CID 170637040
2-[[3-[4-[2-(trifluoromethyl)pyrimidin-5-yl]oxyphenyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid (PubChem CID 170637040) has the molecular formula C17H11F3N4O4 and a molecular weight of 392.29 g/mol. Its IUPAC name is 2-[[3-[4-[2-(trifluoromethyl)pyrimidin-5-yl]oxyphenyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid.
| Compound Name | 2-[[3-[4-[2-(trifluoromethyl)pyrimidin-5-yl]oxyphenyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 170637040 |
| Molecular Formula | C17H11F3N4O4 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 2-[[3-[4-[2-(trifluoromethyl)pyrimidin-5-yl]oxyphenyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid |
| SMILES | C=C(Cc1nc(-c2ccc(Oc3cnc(C(F)(F)F)nc3)cc2)no1)C(=O)O |
| InChI | InChI=1S/C17H11F3N4O4/c1-9(15(25)26)6-13-23-14(24-28-13)10-2-4-11(5-3-10)27-12-7-21-16(22-8-12)17(18,19)20/h2-5,7-8H,1,6H2,(H,25,26) |
| InChIKey | GCQOEHTUSHDOFW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 111.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|