About 2-cyclohexyloxypyridine;2-(1,2,4-oxadiazol-5-ylmethyl)prop-2-enoic acid
2-cyclohexyloxypyridine;2-(1,2,4-oxadiazol-5-ylmethyl)prop-2-enoic acid (PubChem CID 170637059) has the molecular formula C17H21N3O4
and a molecular weight of 331.37 g/mol. Its IUPAC name is 2-cyclohexyloxypyridine;2-(1,2,4-oxadiazol-5-ylmethyl)prop-2-enoic acid.
Molecular Properties
| Compound Name | 2-cyclohexyloxypyridine;2-(1,2,4-oxadiazol-5-ylmethyl)prop-2-enoic acid |
| PubChem CID | 170637059 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-cyclohexyloxypyridine;2-(1,2,4-oxadiazol-5-ylmethyl)prop-2-enoic acid |
| SMILES | C=C(Cc1ncno1)C(=O)O.c1ccc(OC2CCCCC2)nc1 |
| InChI | InChI=1S/C11H15NO.C6H6N2O3/c1-2-6-10(7-3-1)13-11-8-4-5-9-12-11;1-4(6(9)10)2-5-7-3-8-11-5/h4-5,8-10H,1-3,6-7H2;3H,1-2H2,(H,9,10) |
| InChIKey | RCIQJTOGIKSFMN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 98.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexyloxypyridine;2-(1,2,4-oxadiazol-5-ylmethyl)prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyloxypyridine;2-(1,2,4-oxadiazol-5-ylmethyl)prop-2-enoic acid?
The IUPAC name of 2-cyclohexyloxypyridine;2-(1,2,4-oxadiazol-5-ylmethyl)prop-2-enoic acid (CID 170637059) is 2-cyclohexyloxypyridine;2-(1,2,4-oxadiazol-5-ylmethyl)prop-2-enoic acid.
What is the SMILES notation for 2-cyclohexyloxypyridine;2-(1,2,4-oxadiazol-5-ylmethyl)prop-2-enoic acid?
The canonical SMILES for 2-cyclohexyloxypyridine;2-(1,2,4-oxadiazol-5-ylmethyl)prop-2-enoic acid is C=C(Cc1ncno1)C(=O)O.c1ccc(OC2CCCCC2)nc1.
What is the InChIKey of 2-cyclohexyloxypyridine;2-(1,2,4-oxadiazol-5-ylmethyl)prop-2-enoic acid?
The InChIKey is RCIQJTOGIKSFMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO.C6H6N2O3/c1-2-6-10(7-3-1)13-11-8-4-5-9-12-11;1-4(6(9)10)2-5-7-3-8-11-5/h4-5,8-10H,1-3,6-7H2;3H,1-2H2,(H,9,10).
What are the key properties of 2-cyclohexyloxypyridine;2-(1,2,4-oxadiazol-5-ylmethyl)prop-2-enoic acid?
2-cyclohexyloxypyridine;2-(1,2,4-oxadiazol-5-ylmethyl)prop-2-enoic acid has a molecular weight of 331.37 g/mol, XLogP of 3.05, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyloxypyridine;2-(1,2,4-oxadiazol-5-ylmethyl)prop-2-enoic acid is sourced from PubChem (CID 170637059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).