C18H12F3N3O4 — CID 170637085
2-[[3-[4-[[6-(trifluoromethyl)-3-pyridinyl]oxy]phenyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid (PubChem CID 170637085) has the molecular formula C18H12F3N3O4 and a molecular weight of 391.31 g/mol. Its IUPAC name is 2-[[3-[4-[[6-(trifluoromethyl)-3-pyridinyl]oxy]phenyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid.
| Compound Name | 2-[[3-[4-[[6-(trifluoromethyl)-3-pyridinyl]oxy]phenyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 170637085 |
| Molecular Formula | C18H12F3N3O4 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 2-[[3-[4-[[6-(trifluoromethyl)-3-pyridinyl]oxy]phenyl]-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoic acid |
| SMILES | C=C(Cc1nc(-c2ccc(Oc3ccc(C(F)(F)F)nc3)cc2)no1)C(=O)O |
| InChI | InChI=1S/C18H12F3N3O4/c1-10(17(25)26)8-15-23-16(24-28-15)11-2-4-12(5-3-11)27-13-6-7-14(22-9-13)18(19,20)21/h2-7,9H,1,8H2,(H,25,26) |
| InChIKey | ORODHTHGZOLEPW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 98.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|