C13H16N4O3 — CID 170637256
methyl (2S)-3-(3H-benzimidazole-5-carbonylamino)-2-(methylamino)propanoate (PubChem CID 170637256) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is methyl (2S)-3-(3H-benzimidazole-5-carbonylamino)-2-(methylamino)propanoate.
| Compound Name | methyl (2S)-3-(3H-benzimidazole-5-carbonylamino)-2-(methylamino)propanoate |
|---|---|
| PubChem CID | 170637256 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | methyl (2S)-3-(3H-benzimidazole-5-carbonylamino)-2-(methylamino)propanoate |
| SMILES | CN[C@@H](CNC(=O)c1ccc2nc[nH]c2c1)C(=O)OC |
| InChI | InChI=1S/C13H16N4O3/c1-14-11(13(19)20-2)6-15-12(18)8-3-4-9-10(5-8)17-7-16-9/h3-5,7,11,14H,6H2,1-2H3,(H,15,18)(H,16,17)/t11-/m0/s1 |
| InChIKey | ODGUWYGLVFUSRS-NSHDSACASA-N |
| XLogP | 0.05 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |