C34H53Cl2NORu- — CID 170637350
1-[(3Z,5Z)-4-tert-butyl-8,8-dimethylnona-3,5-dien-1-yn-3-yl]-2,2,4,4-tetramethylpyrrolidin-5-ide;chloromethane;chloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium (PubChem CID 170637350) has the molecular formula C34H53Cl2NORu- and a molecular weight of 663.78 g/mol. Its IUPAC name is 1-[(3Z,5Z)-4-tert-butyl-8,8-dimethylnona-3,5-dien-1-yn-3-yl]-2,2,4,4-tetramethylpyrrolidin-5-ide;chloromethane;chloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium.
| Compound Name | 1-[(3Z,5Z)-4-tert-butyl-8,8-dimethylnona-3,5-dien-1-yn-3-yl]-2,2,4,4-tetramethylpyrrolidin-5-ide;chloromethane;chloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium |
|---|---|
| PubChem CID | 170637350 |
| Molecular Formula | C34H53Cl2NORu- |
| Molecular Weight | 663.78 g/mol |
| Exact Mass | 663.26 |
| IUPAC Name | 1-[(3Z,5Z)-4-tert-butyl-8,8-dimethylnona-3,5-dien-1-yn-3-yl]-2,2,4,4-tetramethylpyrrolidin-5-ide;chloromethane;chloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium |
| SMILES | C#C/C(=C(\C=C/CC(C)(C)C)C(C)(C)C)N1[CH-]C(C)(C)CC1(C)C.CC(C)Oc1ccccc1/C=[Ru]/Cl.CCl |
| InChI | InChI=1S/C23H38N.C10H12O.CH3Cl.ClH.Ru/c1-12-19(24-17-22(8,9)16-23(24,10)11)18(21(5,6)7)14-13-15-20(2,3)4;1-8(2)11-10-7-5-4-6-9(10)3;1-2;;/h1,13-14,17H,15-16H2,2-11H3;3-8H,1-2H3;1H3;1H;/q-1;;;;+1/p-1/b14-13-,19-18-;;;; |
| InChIKey | RSLOLTHBRMSDGP-NLQLEKGMSA-M |
| XLogP | 10.30 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.78 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|