C30H27BrClN3 — CID 170637507
3-(4-bromophenyl)-4-[(4-tert-butylphenyl)methyl]-6,16-diaza-4-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,7,10,12,14-heptaene chloride (PubChem CID 170637507) has the molecular formula C30H27BrClN3 and a molecular weight of 544.92 g/mol. Its IUPAC name is 3-(4-bromophenyl)-4-[(4-tert-butylphenyl)methyl]-6,16-diaza-4-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,7,10,12,14-heptaene chloride.
| Compound Name | 3-(4-bromophenyl)-4-[(4-tert-butylphenyl)methyl]-6,16-diaza-4-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,7,10,12,14-heptaene chloride |
|---|---|
| PubChem CID | 170637507 |
| Molecular Formula | C30H27BrClN3 |
| Molecular Weight | 544.92 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | 3-(4-bromophenyl)-4-[(4-tert-butylphenyl)methyl]-6,16-diaza-4-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2,4,7,10,12,14-heptaene chloride |
| SMILES | CC(C)(C)c1ccc(C[n+]2cn3ccc4c5ccccc5[nH]c4c3c2-c2ccc(Br)cc2)cc1.[Cl-] |
| InChI | InChI=1S/C30H27BrN3.ClH/c1-30(2,3)22-12-8-20(9-13-22)18-34-19-33-17-16-25-24-6-4-5-7-26(24)32-27(25)29(33)28(34)21-10-14-23(31)15-11-21;/h4-17,19,32H,18H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | BDOPREJPKQUASI-UHFFFAOYSA-M |
| XLogP | 4.64 |
| TPSA | 24.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.92 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|