C11H27N3OSi — CID 170637665
1-[3-[methoxy(dimethyl)silyl]propyl]-1,2,3,3-tetramethylguanidine (PubChem CID 170637665) has the molecular formula C11H27N3OSi and a molecular weight of 245.44 g/mol. Its IUPAC name is 1-[3-[methoxy(dimethyl)silyl]propyl]-1,2,3,3-tetramethylguanidine.
| Compound Name | 1-[3-[methoxy(dimethyl)silyl]propyl]-1,2,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 170637665 |
| Molecular Formula | C11H27N3OSi |
| Molecular Weight | 245.44 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 1-[3-[methoxy(dimethyl)silyl]propyl]-1,2,3,3-tetramethylguanidine |
| SMILES | C/N=C(\N(C)C)N(C)CCC[Si](C)(C)OC |
| InChI | InChI=1S/C11H27N3OSi/c1-12-11(13(2)3)14(4)9-8-10-16(6,7)15-5/h8-10H2,1-7H3/b12-11+ |
| InChIKey | YPMHJBVEWXCKRJ-VAWYXSNFSA-N |
| XLogP | 1.71 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|