C21H20ClF2N3O6S — CID 170637845
2,2-difluoroethyl 3-[[(E)-3-(4-chlorophenyl)sulfonylprop-2-enyl]carbamoyl]-2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylate (PubChem CID 170637845) has the molecular formula C21H20ClF2N3O6S and a molecular weight of 515.92 g/mol. Its IUPAC name is 2,2-difluoroethyl 3-[[(E)-3-(4-chlorophenyl)sulfonylprop-2-enyl]carbamoyl]-2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylate.
| Compound Name | 2,2-difluoroethyl 3-[[(E)-3-(4-chlorophenyl)sulfonylprop-2-enyl]carbamoyl]-2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylate |
|---|---|
| PubChem CID | 170637845 |
| Molecular Formula | C21H20ClF2N3O6S |
| Molecular Weight | 515.92 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | 2,2-difluoroethyl 3-[[(E)-3-(4-chlorophenyl)sulfonylprop-2-enyl]carbamoyl]-2-oxo-1,5,7,8-tetrahydro-1,6-naphthyridine-6-carboxylate |
| SMILES | O=C(NC/C=C/S(=O)(=O)c1ccc(Cl)cc1)c1cc2c([nH]c1=O)CCN(C(=O)OCC(F)F)C2 |
| InChI | InChI=1S/C21H20ClF2N3O6S/c22-14-2-4-15(5-3-14)34(31,32)9-1-7-25-19(28)16-10-13-11-27(21(30)33-12-18(23)24)8-6-17(13)26-20(16)29/h1-5,9-10,18H,6-8,11-12H2,(H,25,28)(H,26,29)/b9-1+ |
| InChIKey | LZYRSCYGRRTBDI-XLUWADSXSA-N |
| XLogP | 2.51 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.92 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |