About 2-[[4-(3-fluorophenyl)cyclohexyl]oxymethyl]pentane-1,3-diamine
2-[[4-(3-fluorophenyl)cyclohexyl]oxymethyl]pentane-1,3-diamine (PubChem CID 170638276) has the molecular formula C18H29FN2O
and a molecular weight of 308.44 g/mol. Its IUPAC name is 2-[[4-(3-fluorophenyl)cyclohexyl]oxymethyl]pentane-1,3-diamine.
Molecular Properties
| Compound Name | 2-[[4-(3-fluorophenyl)cyclohexyl]oxymethyl]pentane-1,3-diamine |
| PubChem CID | 170638276 |
| Molecular Formula | C18H29FN2O |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 2-[[4-(3-fluorophenyl)cyclohexyl]oxymethyl]pentane-1,3-diamine |
| SMILES | CCC(N)C(CN)COC1CCC(c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C18H29FN2O/c1-2-18(21)15(11-20)12-22-17-8-6-13(7-9-17)14-4-3-5-16(19)10-14/h3-5,10,13,15,17-18H,2,6-9,11-12,20-21H2,1H3 |
| InChIKey | QEECGALIDFCMFA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[4-(3-fluorophenyl)cyclohexyl]oxymethyl]pentane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(3-fluorophenyl)cyclohexyl]oxymethyl]pentane-1,3-diamine?
The IUPAC name of 2-[[4-(3-fluorophenyl)cyclohexyl]oxymethyl]pentane-1,3-diamine (CID 170638276) is 2-[[4-(3-fluorophenyl)cyclohexyl]oxymethyl]pentane-1,3-diamine.
What is the SMILES notation for 2-[[4-(3-fluorophenyl)cyclohexyl]oxymethyl]pentane-1,3-diamine?
The canonical SMILES for 2-[[4-(3-fluorophenyl)cyclohexyl]oxymethyl]pentane-1,3-diamine is CCC(N)C(CN)COC1CCC(c2cccc(F)c2)CC1.
What is the InChIKey of 2-[[4-(3-fluorophenyl)cyclohexyl]oxymethyl]pentane-1,3-diamine?
The InChIKey is QEECGALIDFCMFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29FN2O/c1-2-18(21)15(11-20)12-22-17-8-6-13(7-9-17)14-4-3-5-16(19)10-14/h3-5,10,13,15,17-18H,2,6-9,11-12,20-21H2,1H3.
What are the key properties of 2-[[4-(3-fluorophenyl)cyclohexyl]oxymethyl]pentane-1,3-diamine?
2-[[4-(3-fluorophenyl)cyclohexyl]oxymethyl]pentane-1,3-diamine has a molecular weight of 308.44 g/mol, XLogP of 3.18, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(3-fluorophenyl)cyclohexyl]oxymethyl]pentane-1,3-diamine is sourced from PubChem (CID 170638276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).