C26H36N6O — CID 170638499
(3R,4S)-3-[2-[4-(1-methylindazol-5-yl)cyclohexyl]ethoxymethyl]-1-pyridazin-3-ylpiperidin-4-amine (PubChem CID 170638499) has the molecular formula C26H36N6O and a molecular weight of 448.62 g/mol. Its IUPAC name is (3R,4S)-3-[2-[4-(1-methylindazol-5-yl)cyclohexyl]ethoxymethyl]-1-pyridazin-3-ylpiperidin-4-amine.
| Compound Name | (3R,4S)-3-[2-[4-(1-methylindazol-5-yl)cyclohexyl]ethoxymethyl]-1-pyridazin-3-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 170638499 |
| Molecular Formula | C26H36N6O |
| Molecular Weight | 448.62 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | (3R,4S)-3-[2-[4-(1-methylindazol-5-yl)cyclohexyl]ethoxymethyl]-1-pyridazin-3-ylpiperidin-4-amine |
| SMILES | Cn1ncc2cc(C3CCC(CCOC[C@@H]4CN(c5cccnn5)CC[C@@H]4N)CC3)ccc21 |
| InChI | InChI=1S/C26H36N6O/c1-31-25-9-8-21(15-22(25)16-29-31)20-6-4-19(5-7-20)11-14-33-18-23-17-32(13-10-24(23)27)26-3-2-12-28-30-26/h2-3,8-9,12,15-16,19-20,23-24H,4-7,10-11,13-14,17-18,27H2,1H3/t19?,20?,23-,24-/m0/s1 |
| InChIKey | RMMTZDHHXPQXPQ-WVYIWEFDSA-N |
| XLogP | 3.90 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.62 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|