C8H13F6NO — CID 170638903
2-[(2,3,3,4,4,4-hexafluoro-2-methylbutyl)-methylamino]ethanol (PubChem CID 170638903) has the molecular formula C8H13F6NO and a molecular weight of 253.19 g/mol. Its IUPAC name is 2-[(2,3,3,4,4,4-hexafluoro-2-methylbutyl)-methylamino]ethanol.
| Compound Name | 2-[(2,3,3,4,4,4-hexafluoro-2-methylbutyl)-methylamino]ethanol |
|---|---|
| PubChem CID | 170638903 |
| Molecular Formula | C8H13F6NO |
| Molecular Weight | 253.19 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-[(2,3,3,4,4,4-hexafluoro-2-methylbutyl)-methylamino]ethanol |
| SMILES | CN(CCO)CC(C)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H13F6NO/c1-6(9,5-15(2)3-4-16)7(10,11)8(12,13)14/h16H,3-5H2,1-2H3 |
| InChIKey | XPPQXCOZWQQBBH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.19 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|