C17H24F3N5 — CID 170639587
ethane;2-methyl-4-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]-5-(trifluoromethyl)pyrimidine (PubChem CID 170639587) has the molecular formula C17H24F3N5 and a molecular weight of 355.41 g/mol. Its IUPAC name is ethane;2-methyl-4-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]-5-(trifluoromethyl)pyrimidine.
| Compound Name | ethane;2-methyl-4-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]-5-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 170639587 |
| Molecular Formula | C17H24F3N5 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | ethane;2-methyl-4-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]-5-(trifluoromethyl)pyrimidine |
| SMILES | CC.Cc1ncc(C(F)(F)F)c(-c2cnn(C3CCN(C)CC3)c2)n1 |
| InChI | InChI=1S/C15H18F3N5.C2H6/c1-10-19-8-13(15(16,17)18)14(21-10)11-7-20-23(9-11)12-3-5-22(2)6-4-12;1-2/h7-9,12H,3-6H2,1-2H3;1-2H3 |
| InChIKey | YXDDAWUQEWIPPY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |