C22H30ClF3N8S — CID 170639653
N-[1-[2-(chloromethyl)-3-methylimidazol-4-yl]sulfanylpiperidin-4-yl]-4-(1-ethylpyrazol-4-yl)-5-(trifluoromethyl)pyrimidin-2-amine;ethane (PubChem CID 170639653) has the molecular formula C22H30ClF3N8S and a molecular weight of 531.05 g/mol. Its IUPAC name is N-[1-[2-(chloromethyl)-3-methylimidazol-4-yl]sulfanylpiperidin-4-yl]-4-(1-ethylpyrazol-4-yl)-5-(trifluoromethyl)pyrimidin-2-amine;ethane.
| Compound Name | N-[1-[2-(chloromethyl)-3-methylimidazol-4-yl]sulfanylpiperidin-4-yl]-4-(1-ethylpyrazol-4-yl)-5-(trifluoromethyl)pyrimidin-2-amine;ethane |
|---|---|
| PubChem CID | 170639653 |
| Molecular Formula | C22H30ClF3N8S |
| Molecular Weight | 531.05 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | N-[1-[2-(chloromethyl)-3-methylimidazol-4-yl]sulfanylpiperidin-4-yl]-4-(1-ethylpyrazol-4-yl)-5-(trifluoromethyl)pyrimidin-2-amine;ethane |
| SMILES | CC.CCn1cc(-c2nc(NC3CCN(Sc4cnc(CCl)n4C)CC3)ncc2C(F)(F)F)cn1 |
| InChI | InChI=1S/C20H24ClF3N8S.C2H6/c1-3-31-12-13(9-27-31)18-15(20(22,23)24)10-26-19(29-18)28-14-4-6-32(7-5-14)33-17-11-25-16(8-21)30(17)2;1-2/h9-12,14H,3-8H2,1-2H3,(H,26,28,29);1-2H3 |
| InChIKey | IDOUKTOOWOKIKL-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 76.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.05 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|