C11H14F3N3O2S — CID 170640103
2-methylsulfonyl-4-piperidin-1-yl-5-(trifluoromethyl)pyrimidine (PubChem CID 170640103) has the molecular formula C11H14F3N3O2S and a molecular weight of 309.31 g/mol. Its IUPAC name is 2-methylsulfonyl-4-piperidin-1-yl-5-(trifluoromethyl)pyrimidine.
| Compound Name | 2-methylsulfonyl-4-piperidin-1-yl-5-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 170640103 |
| Molecular Formula | C11H14F3N3O2S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 2-methylsulfonyl-4-piperidin-1-yl-5-(trifluoromethyl)pyrimidine |
| SMILES | CS(=O)(=O)c1ncc(C(F)(F)F)c(N2CCCCC2)n1 |
| InChI | InChI=1S/C11H14F3N3O2S/c1-20(18,19)10-15-7-8(11(12,13)14)9(16-10)17-5-3-2-4-6-17/h7H,2-6H2,1H3 |
| InChIKey | CILYHVRLZIMUQL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |