C16H26FNO2 — CID 170640580
1-amino-1-[2-fluoro-4-(2-methylpentoxy)phenyl]-2-methylpropan-2-ol (PubChem CID 170640580) has the molecular formula C16H26FNO2 and a molecular weight of 283.39 g/mol. Its IUPAC name is 1-amino-1-[2-fluoro-4-(2-methylpentoxy)phenyl]-2-methylpropan-2-ol.
| Compound Name | 1-amino-1-[2-fluoro-4-(2-methylpentoxy)phenyl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 170640580 |
| Molecular Formula | C16H26FNO2 |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 1-amino-1-[2-fluoro-4-(2-methylpentoxy)phenyl]-2-methylpropan-2-ol |
| SMILES | CCCC(C)COc1ccc(C(N)C(C)(C)O)c(F)c1 |
| InChI | InChI=1S/C16H26FNO2/c1-5-6-11(2)10-20-12-7-8-13(14(17)9-12)15(18)16(3,4)19/h7-9,11,15,19H,5-6,10,18H2,1-4H3 |
| InChIKey | UEODJBUPSQRXTE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |