About 6-chloro-1-[6-(oxetan-3-yl)-2-pyridinyl]spiro[2H-pyrrolo[3,2-c]pyridine-3,1'-cyclopropane]
6-chloro-1-[6-(oxetan-3-yl)-2-pyridinyl]spiro[2H-pyrrolo[3,2-c]pyridine-3,1'-cyclopropane] (PubChem CID 170640609) has the molecular formula C17H16ClN3O
and a molecular weight of 313.79 g/mol. Its IUPAC name is 6-chloro-1-[6-(oxetan-3-yl)-2-pyridinyl]spiro[2H-pyrrolo[3,2-c]pyridine-3,1'-cyclopropane].
Molecular Properties
| Compound Name | 6-chloro-1-[6-(oxetan-3-yl)-2-pyridinyl]spiro[2H-pyrrolo[3,2-c]pyridine-3,1'-cyclopropane] |
| PubChem CID | 170640609 |
| Molecular Formula | C17H16ClN3O |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 6-chloro-1-[6-(oxetan-3-yl)-2-pyridinyl]spiro[2H-pyrrolo[3,2-c]pyridine-3,1'-cyclopropane] |
| SMILES | Clc1cc2c(cn1)C1(CC1)CN2c1cccc(C2COC2)n1 |
| InChI | InChI=1S/C17H16ClN3O/c18-15-6-14-12(7-19-15)17(4-5-17)10-21(14)16-3-1-2-13(20-16)11-8-22-9-11/h1-3,6-7,11H,4-5,8-10H2 |
| InChIKey | LWQHVSOJMUVQAC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-1-[6-(oxetan-3-yl)-2-pyridinyl]spiro[2H-pyrrolo[3,2-c]pyridine-3,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1-[6-(oxetan-3-yl)-2-pyridinyl]spiro[2H-pyrrolo[3,2-c]pyridine-3,1'-cyclopropane]?
The IUPAC name of 6-chloro-1-[6-(oxetan-3-yl)-2-pyridinyl]spiro[2H-pyrrolo[3,2-c]pyridine-3,1'-cyclopropane] (CID 170640609) is 6-chloro-1-[6-(oxetan-3-yl)-2-pyridinyl]spiro[2H-pyrrolo[3,2-c]pyridine-3,1'-cyclopropane].
What is the SMILES notation for 6-chloro-1-[6-(oxetan-3-yl)-2-pyridinyl]spiro[2H-pyrrolo[3,2-c]pyridine-3,1'-cyclopropane]?
The canonical SMILES for 6-chloro-1-[6-(oxetan-3-yl)-2-pyridinyl]spiro[2H-pyrrolo[3,2-c]pyridine-3,1'-cyclopropane] is Clc1cc2c(cn1)C1(CC1)CN2c1cccc(C2COC2)n1.
What is the InChIKey of 6-chloro-1-[6-(oxetan-3-yl)-2-pyridinyl]spiro[2H-pyrrolo[3,2-c]pyridine-3,1'-cyclopropane]?
The InChIKey is LWQHVSOJMUVQAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClN3O/c18-15-6-14-12(7-19-15)17(4-5-17)10-21(14)16-3-1-2-13(20-16)11-8-22-9-11/h1-3,6-7,11H,4-5,8-10H2.
What are the key properties of 6-chloro-1-[6-(oxetan-3-yl)-2-pyridinyl]spiro[2H-pyrrolo[3,2-c]pyridine-3,1'-cyclopropane]?
6-chloro-1-[6-(oxetan-3-yl)-2-pyridinyl]spiro[2H-pyrrolo[3,2-c]pyridine-3,1'-cyclopropane] has a molecular weight of 313.79 g/mol, XLogP of 3.43, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1-[6-(oxetan-3-yl)-2-pyridinyl]spiro[2H-pyrrolo[3,2-c]pyridine-3,1'-cyclopropane] is sourced from PubChem (CID 170640609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).