C25H29F2N7O2 — CID 170641770
3-[[5-[3-(2,2-difluoroethyl)-2-methylbenzimidazol-5-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-N,N,1-trimethylcyclobutane-1-carboxamide (PubChem CID 170641770) has the molecular formula C25H29F2N7O2 and a molecular weight of 497.55 g/mol. Its IUPAC name is 3-[[5-[3-(2,2-difluoroethyl)-2-methylbenzimidazol-5-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-N,N,1-trimethylcyclobutane-1-carboxamide.
| Compound Name | 3-[[5-[3-(2,2-difluoroethyl)-2-methylbenzimidazol-5-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-N,N,1-trimethylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 170641770 |
| Molecular Formula | C25H29F2N7O2 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | 3-[[5-[3-(2,2-difluoroethyl)-2-methylbenzimidazol-5-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-N,N,1-trimethylcyclobutane-1-carboxamide |
| SMILES | COc1nc(NC2CC(C)(C(=O)N(C)C)C2)nn2ccc(-c3ccc4nc(C)n(CC(F)F)c4c3)c12 |
| InChI | InChI=1S/C25H29F2N7O2/c1-14-28-18-7-6-15(10-19(18)33(14)13-20(26)27)17-8-9-34-21(17)22(36-5)30-24(31-34)29-16-11-25(2,12-16)23(35)32(3)4/h6-10,16,20H,11-13H2,1-5H3,(H,29,31) |
| InChIKey | BGHSXRIPLXVASJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 89.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |