C9H17N — CID 170641816
1,3-dimethyl-N-prop-1-en-2-ylcyclobutan-1-amine (PubChem CID 170641816) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is 1,3-dimethyl-N-prop-1-en-2-ylcyclobutan-1-amine.
| Compound Name | 1,3-dimethyl-N-prop-1-en-2-ylcyclobutan-1-amine |
|---|---|
| PubChem CID | 170641816 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | 1,3-dimethyl-N-prop-1-en-2-ylcyclobutan-1-amine |
| SMILES | C=C(C)NC1(C)CC(C)C1 |
| InChI | InChI=1S/C9H17N/c1-7(2)10-9(4)5-8(3)6-9/h8,10H,1,5-6H2,2-4H3 |
| InChIKey | FSYKPWLZERDIIG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |