C20H20F3N7O — CID 170641926
N-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-5-(8-fluoroimidazo[1,2-a]pyridin-6-yl)-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170641926) has the molecular formula C20H20F3N7O and a molecular weight of 431.42 g/mol. Its IUPAC name is N-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-5-(8-fluoroimidazo[1,2-a]pyridin-6-yl)-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | N-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-5-(8-fluoroimidazo[1,2-a]pyridin-6-yl)-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170641926 |
| Molecular Formula | C20H20F3N7O |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | N-[(4R)-3,3-difluoro-1-methylpiperidin-4-yl]-5-(8-fluoroimidazo[1,2-a]pyridin-6-yl)-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | COc1nc(N[C@@H]2CCN(C)CC2(F)F)nn2ccc(-c3cc(F)c4nccn4c3)c12 |
| InChI | InChI=1S/C20H20F3N7O/c1-28-6-4-15(20(22,23)11-28)25-19-26-18(31-2)16-13(3-7-30(16)27-19)12-9-14(21)17-24-5-8-29(17)10-12/h3,5,7-10,15H,4,6,11H2,1-2H3,(H,25,27)/t15-/m1/s1 |
| InChIKey | CXASGVNQEDEDGL-OAHLLOKOSA-N |
| XLogP | 2.94 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |