C18H18FN7O2 — CID 170641978
N-[(3S,4R)-3-fluorooxan-4-yl]-5-imidazo[1,2-a]pyrimidin-6-yl-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170641978) has the molecular formula C18H18FN7O2 and a molecular weight of 383.39 g/mol. Its IUPAC name is N-[(3S,4R)-3-fluorooxan-4-yl]-5-imidazo[1,2-a]pyrimidin-6-yl-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | N-[(3S,4R)-3-fluorooxan-4-yl]-5-imidazo[1,2-a]pyrimidin-6-yl-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170641978 |
| Molecular Formula | C18H18FN7O2 |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-[(3S,4R)-3-fluorooxan-4-yl]-5-imidazo[1,2-a]pyrimidin-6-yl-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | COc1nc(N[C@@H]2CCOC[C@H]2F)nn2ccc(-c3cnc4nccn4c3)c12 |
| InChI | InChI=1S/C18H18FN7O2/c1-27-16-15-12(11-8-21-18-20-4-6-25(18)9-11)2-5-26(15)24-17(23-16)22-14-3-7-28-10-13(14)19/h2,4-6,8-9,13-14H,3,7,10H2,1H3,(H,22,24)/t13-,14-/m1/s1 |
| InChIKey | YAIRQSKMORQYEZ-ZIAGYGMSSA-N |
| XLogP | 1.99 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |