C23H24F4N8O2 — CID 170642023
5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-N-[(4R)-3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170642023) has the molecular formula C23H24F4N8O2 and a molecular weight of 520.49 g/mol. Its IUPAC name is 5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-N-[(4R)-3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-N-[(4R)-3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170642023 |
| Molecular Formula | C23H24F4N8O2 |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | 5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-N-[(4R)-3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | COc1nc(N[C@@H]2CCN(C3COC3)CC2(F)F)nn2ccc(-c3ccc4nnn(CC(F)F)c4c3)c12 |
| InChI | InChI=1S/C23H24F4N8O2/c1-36-21-20-15(13-2-3-16-17(8-13)35(32-30-16)9-19(24)25)4-7-34(20)31-22(29-21)28-18-5-6-33(12-23(18,26)27)14-10-37-11-14/h2-4,7-8,14,18-19H,5-6,9-12H2,1H3,(H,28,31)/t18-/m1/s1 |
| InChIKey | RKLTXOBJTDUMLT-GOSISDBHSA-N |
| XLogP | 2.93 |
| TPSA | 94.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |