C23H24F4N8O2 — CID 170642223
1-[(4R)-4-[[5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3,3-difluoropiperidin-1-yl]propan-1-one (PubChem CID 170642223) has the molecular formula C23H24F4N8O2 and a molecular weight of 520.49 g/mol. Its IUPAC name is 1-[(4R)-4-[[5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3,3-difluoropiperidin-1-yl]propan-1-one.
| Compound Name | 1-[(4R)-4-[[5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3,3-difluoropiperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 170642223 |
| Molecular Formula | C23H24F4N8O2 |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | 1-[(4R)-4-[[5-[3-(2,2-difluoroethyl)benzotriazol-5-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]-3,3-difluoropiperidin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CC[C@@H](Nc2nc(OC)c3c(-c4ccc5nnn(CC(F)F)c5c4)ccn3n2)C(F)(F)C1 |
| InChI | InChI=1S/C23H24F4N8O2/c1-3-19(36)33-8-7-17(23(26,27)12-33)28-22-29-21(37-2)20-14(6-9-34(20)31-22)13-4-5-15-16(10-13)35(32-30-15)11-18(24)25/h4-6,9-10,17-18H,3,7-8,11-12H2,1-2H3,(H,28,31)/t17-/m1/s1 |
| InChIKey | WGENURCGGJMXCU-QGZVFWFLSA-N |
| XLogP | 3.47 |
| TPSA | 102.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |