C30H32N2O4 — CID 17064267
6-(2,3-dimethoxyphenyl)-9-(4-propoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 17064267) has the molecular formula C30H32N2O4 and a molecular weight of 484.60 g/mol. Its IUPAC name is 6-(2,3-dimethoxyphenyl)-9-(4-propoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-(2,3-dimethoxyphenyl)-9-(4-propoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 17064267 |
| Molecular Formula | C30H32N2O4 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | 6-(2,3-dimethoxyphenyl)-9-(4-propoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCCOc1ccc(C2CC(=O)C3=C(C2)Nc2ccccc2NC3c2cccc(OC)c2OC)cc1 |
| InChI | InChI=1S/C30H32N2O4/c1-4-16-36-21-14-12-19(13-15-21)20-17-25-28(26(33)18-20)29(32-24-10-6-5-9-23(24)31-25)22-8-7-11-27(34-2)30(22)35-3/h5-15,20,29,31-32H,4,16-18H2,1-3H3 |
| InChIKey | MGMYIFLROQVWAA-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |