C18H15N5O — CID 170642829
4-methoxy-5-[(6S)-6-methyl-2-azabicyclo[5.4.0]undeca-1(7),2,8,10-tetraen-4-yn-10-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170642829) has the molecular formula C18H15N5O and a molecular weight of 317.35 g/mol. Its IUPAC name is 4-methoxy-5-[(6S)-6-methyl-2-azabicyclo[5.4.0]undeca-1(7),2,8,10-tetraen-4-yn-10-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 4-methoxy-5-[(6S)-6-methyl-2-azabicyclo[5.4.0]undeca-1(7),2,8,10-tetraen-4-yn-10-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170642829 |
| Molecular Formula | C18H15N5O |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 4-methoxy-5-[(6S)-6-methyl-2-azabicyclo[5.4.0]undeca-1(7),2,8,10-tetraen-4-yn-10-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | COc1nc(N)nn2ccc(-c3ccc4c(c3)N=CC#C[C@@H]4C)c12 |
| InChI | InChI=1S/C18H15N5O/c1-11-4-3-8-20-15-10-12(5-6-13(11)15)14-7-9-23-16(14)17(24-2)21-18(19)22-23/h5-11H,1-2H3,(H2,19,22)/t11-/m0/s1 |
| InChIKey | FWDOVNBFUKGSLX-NSHDSACASA-N |
| XLogP | 2.81 |
| TPSA | 77.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|