C29H38F4N6 — CID 170642924
N-(1-cyclobutyl-3,3-difluoropiperidin-4-yl)-4-methyl-5-[3-methyl-4-(propan-2-ylideneamino)phenyl]pyrrolo[2,1-f][1,2,4]triazin-2-amine;1,1-difluoropropane (PubChem CID 170642924) has the molecular formula C29H38F4N6 and a molecular weight of 546.66 g/mol. Its IUPAC name is N-(1-cyclobutyl-3,3-difluoropiperidin-4-yl)-4-methyl-5-[3-methyl-4-(propan-2-ylideneamino)phenyl]pyrrolo[2,1-f][1,2,4]triazin-2-amine;1,1-difluoropropane.
| Compound Name | N-(1-cyclobutyl-3,3-difluoropiperidin-4-yl)-4-methyl-5-[3-methyl-4-(propan-2-ylideneamino)phenyl]pyrrolo[2,1-f][1,2,4]triazin-2-amine;1,1-difluoropropane |
|---|---|
| PubChem CID | 170642924 |
| Molecular Formula | C29H38F4N6 |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | N-(1-cyclobutyl-3,3-difluoropiperidin-4-yl)-4-methyl-5-[3-methyl-4-(propan-2-ylideneamino)phenyl]pyrrolo[2,1-f][1,2,4]triazin-2-amine;1,1-difluoropropane |
| SMILES | CC(C)=Nc1ccc(-c2ccn3nc(NC4CCN(C5CCC5)CC4(F)F)nc(C)c23)cc1C.CCC(F)F |
| InChI | InChI=1S/C26H32F2N6.C3H6F2/c1-16(2)29-22-9-8-19(14-17(22)3)21-10-13-34-24(21)18(4)30-25(32-34)31-23-11-12-33(15-26(23,27)28)20-6-5-7-20;1-2-3(4)5/h8-10,13-14,20,23H,5-7,11-12,15H2,1-4H3,(H,31,32);3H,2H2,1H3 |
| InChIKey | ZORRBNDMJAOKOB-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|