C21H25F3N8O — CID 170642999
5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-N-[(3R,4S)-1-ethyl-4-fluoropyrrolidin-3-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170642999) has the molecular formula C21H25F3N8O and a molecular weight of 462.48 g/mol. Its IUPAC name is 5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-N-[(3R,4S)-1-ethyl-4-fluoropyrrolidin-3-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-N-[(3R,4S)-1-ethyl-4-fluoropyrrolidin-3-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170642999 |
| Molecular Formula | C21H25F3N8O |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-N-[(3R,4S)-1-ethyl-4-fluoropyrrolidin-3-yl]-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | [H]/N=N/c1ccc(-c2ccn3nc(N[C@@H]4CN(CC)C[C@@H]4F)nc(OC)c23)cc1NCC(F)F |
| InChI | InChI=1S/C21H25F3N8O/c1-3-31-10-14(22)17(11-31)27-21-28-20(33-2)19-13(6-7-32(19)30-21)12-4-5-15(29-25)16(8-12)26-9-18(23)24/h4-8,14,17-18,25-26H,3,9-11H2,1-2H3,(H,27,30)/b29-25+/t14-,17+/m0/s1 |
| InChIKey | KVGOSVKDLNPXFT-PSTDVNEASA-N |
| XLogP | 4.20 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|