C23H23F5N8O2 — CID 170643000
N-[(4R)-3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-4-methoxy-5-[3-(2,2,2-trifluoroethyl)benzotriazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170643000) has the molecular formula C23H23F5N8O2 and a molecular weight of 538.48 g/mol. Its IUPAC name is N-[(4R)-3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-4-methoxy-5-[3-(2,2,2-trifluoroethyl)benzotriazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | N-[(4R)-3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-4-methoxy-5-[3-(2,2,2-trifluoroethyl)benzotriazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170643000 |
| Molecular Formula | C23H23F5N8O2 |
| Molecular Weight | 538.48 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | N-[(4R)-3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-4-methoxy-5-[3-(2,2,2-trifluoroethyl)benzotriazol-5-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | COc1nc(N[C@@H]2CCN(C3COC3)CC2(F)F)nn2ccc(-c3ccc4nnn(CC(F)(F)F)c4c3)c12 |
| InChI | InChI=1S/C23H23F5N8O2/c1-37-20-19-15(13-2-3-16-17(8-13)36(33-31-16)12-23(26,27)28)4-7-35(19)32-21(30-20)29-18-5-6-34(11-22(18,24)25)14-9-38-10-14/h2-4,7-8,14,18H,5-6,9-12H2,1H3,(H,29,32)/t18-/m1/s1 |
| InChIKey | GBPWVHZBZJWSHI-GOSISDBHSA-N |
| XLogP | 3.23 |
| TPSA | 94.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |