C23H28F2N8O2 — CID 170643103
5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxy-N-[1-(oxetan-3-yl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170643103) has the molecular formula C23H28F2N8O2 and a molecular weight of 486.53 g/mol. Its IUPAC name is 5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxy-N-[1-(oxetan-3-yl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxy-N-[1-(oxetan-3-yl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170643103 |
| Molecular Formula | C23H28F2N8O2 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 5-[4-diazenyl-3-(2,2-difluoroethylamino)phenyl]-4-methoxy-N-[1-(oxetan-3-yl)piperidin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | [H]/N=N/c1ccc(-c2ccn3nc(NC4CCN(C5COC5)CC4)nc(OC)c23)cc1NCC(F)F |
| InChI | InChI=1S/C23H28F2N8O2/c1-34-22-21-17(14-2-3-18(30-26)19(10-14)27-11-20(24)25)6-9-33(21)31-23(29-22)28-15-4-7-32(8-5-15)16-12-35-13-16/h2-3,6,9-10,15-16,20,26-27H,4-5,7-8,11-13H2,1H3,(H,28,31)/b30-26+ |
| InChIKey | HHUBZCFWNFGNCZ-URGPHPNLSA-N |
| XLogP | 4.02 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|