C22H22F3N7O2 — CID 170643324
N-[(4R)-3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-5-(8-fluoroimidazo[1,2-a]pyridin-6-yl)-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170643324) has the molecular formula C22H22F3N7O2 and a molecular weight of 473.46 g/mol. Its IUPAC name is N-[(4R)-3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-5-(8-fluoroimidazo[1,2-a]pyridin-6-yl)-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | N-[(4R)-3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-5-(8-fluoroimidazo[1,2-a]pyridin-6-yl)-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170643324 |
| Molecular Formula | C22H22F3N7O2 |
| Molecular Weight | 473.46 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | N-[(4R)-3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-5-(8-fluoroimidazo[1,2-a]pyridin-6-yl)-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | COc1nc(N[C@@H]2CCN(C3COC3)CC2(F)F)nn2ccc(-c3cc(F)c4nccn4c3)c12 |
| InChI | InChI=1S/C22H22F3N7O2/c1-33-20-18-15(13-8-16(23)19-26-4-7-30(19)9-13)2-6-32(18)29-21(28-20)27-17-3-5-31(12-22(17,24)25)14-10-34-11-14/h2,4,6-9,14,17H,3,5,10-12H2,1H3,(H,27,29)/t17-/m1/s1 |
| InChIKey | UJTUGOOSLDBNJK-QGZVFWFLSA-N |
| XLogP | 2.71 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |