C23H25Cl2F2N3 — CID 170643963
N-benzyl-3,5-dichloro-2-cyclohex-3-en-1-yl-1-(difluoromethyl)pyrrolo[3,2-b]pyridin-7-amine;ethane (PubChem CID 170643963) has the molecular formula C23H25Cl2F2N3 and a molecular weight of 452.38 g/mol. Its IUPAC name is N-benzyl-3,5-dichloro-2-cyclohex-3-en-1-yl-1-(difluoromethyl)pyrrolo[3,2-b]pyridin-7-amine;ethane.
| Compound Name | N-benzyl-3,5-dichloro-2-cyclohex-3-en-1-yl-1-(difluoromethyl)pyrrolo[3,2-b]pyridin-7-amine;ethane |
|---|---|
| PubChem CID | 170643963 |
| Molecular Formula | C23H25Cl2F2N3 |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-benzyl-3,5-dichloro-2-cyclohex-3-en-1-yl-1-(difluoromethyl)pyrrolo[3,2-b]pyridin-7-amine;ethane |
| SMILES | CC.FC(F)n1c(C2CC=CCC2)c(Cl)c2nc(Cl)cc(NCc3ccccc3)c21 |
| InChI | InChI=1S/C21H19Cl2F2N3.C2H6/c22-16-11-15(26-12-13-7-3-1-4-8-13)20-18(27-16)17(23)19(28(20)21(24)25)14-9-5-2-6-10-14;1-2/h1-5,7-8,11,14,21H,6,9-10,12H2,(H,26,27);1-2H3 |
| InChIKey | NZBVNVSFMIDUIT-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|