About N-benzyl-5-chloro-3-prop-1-ynylthieno[3,2-b]pyridin-7-amine
N-benzyl-5-chloro-3-prop-1-ynylthieno[3,2-b]pyridin-7-amine (PubChem CID 170644169) has the molecular formula C17H13ClN2S
and a molecular weight of 312.83 g/mol. Its IUPAC name is N-benzyl-5-chloro-3-prop-1-ynylthieno[3,2-b]pyridin-7-amine.
Molecular Properties
| Compound Name | N-benzyl-5-chloro-3-prop-1-ynylthieno[3,2-b]pyridin-7-amine |
| PubChem CID | 170644169 |
| Molecular Formula | C17H13ClN2S |
| Molecular Weight | 312.83 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | N-benzyl-5-chloro-3-prop-1-ynylthieno[3,2-b]pyridin-7-amine |
| SMILES | CC#Cc1csc2c(NCc3ccccc3)cc(Cl)nc12 |
| InChI | InChI=1S/C17H13ClN2S/c1-2-6-13-11-21-17-14(9-15(18)20-16(13)17)19-10-12-7-4-3-5-8-12/h3-5,7-9,11H,10H2,1H3,(H,19,20) |
| InChIKey | QPXZAZRUBQAVCX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.83 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-5-chloro-3-prop-1-ynylthieno[3,2-b]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-5-chloro-3-prop-1-ynylthieno[3,2-b]pyridin-7-amine?
The IUPAC name of N-benzyl-5-chloro-3-prop-1-ynylthieno[3,2-b]pyridin-7-amine (CID 170644169) is N-benzyl-5-chloro-3-prop-1-ynylthieno[3,2-b]pyridin-7-amine.
What is the SMILES notation for N-benzyl-5-chloro-3-prop-1-ynylthieno[3,2-b]pyridin-7-amine?
The canonical SMILES for N-benzyl-5-chloro-3-prop-1-ynylthieno[3,2-b]pyridin-7-amine is CC#Cc1csc2c(NCc3ccccc3)cc(Cl)nc12.
What is the InChIKey of N-benzyl-5-chloro-3-prop-1-ynylthieno[3,2-b]pyridin-7-amine?
The InChIKey is QPXZAZRUBQAVCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClN2S/c1-2-6-13-11-21-17-14(9-15(18)20-16(13)17)19-10-12-7-4-3-5-8-12/h3-5,7-9,11H,10H2,1H3,(H,19,20).
What are the key properties of N-benzyl-5-chloro-3-prop-1-ynylthieno[3,2-b]pyridin-7-amine?
N-benzyl-5-chloro-3-prop-1-ynylthieno[3,2-b]pyridin-7-amine has a molecular weight of 312.83 g/mol, XLogP of 4.93, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-5-chloro-3-prop-1-ynylthieno[3,2-b]pyridin-7-amine is sourced from PubChem (CID 170644169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).