About N-benzyl-5-chloro-3-methyl-2-(oxan-2-yl)thieno[3,2-b]pyridin-7-amine;ethane
N-benzyl-5-chloro-3-methyl-2-(oxan-2-yl)thieno[3,2-b]pyridin-7-amine;ethane (PubChem CID 170644363) has the molecular formula C22H27ClN2OS
and a molecular weight of 402.99 g/mol. Its IUPAC name is N-benzyl-5-chloro-3-methyl-2-(oxan-2-yl)thieno[3,2-b]pyridin-7-amine;ethane.
Molecular Properties
| Compound Name | N-benzyl-5-chloro-3-methyl-2-(oxan-2-yl)thieno[3,2-b]pyridin-7-amine;ethane |
| PubChem CID | 170644363 |
| Molecular Formula | C22H27ClN2OS |
| Molecular Weight | 402.99 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-benzyl-5-chloro-3-methyl-2-(oxan-2-yl)thieno[3,2-b]pyridin-7-amine;ethane |
| SMILES | CC.Cc1c(C2CCCCO2)sc2c(NCc3ccccc3)cc(Cl)nc12 |
| InChI | InChI=1S/C20H21ClN2OS.C2H6/c1-13-18-20(25-19(13)16-9-5-6-10-24-16)15(11-17(21)23-18)22-12-14-7-3-2-4-8-14;1-2/h2-4,7-8,11,16H,5-6,9-10,12H2,1H3,(H,22,23);1-2H3 |
| InChIKey | CUWOJCYFQYMQSW-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.99 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-5-chloro-3-methyl-2-(oxan-2-yl)thieno[3,2-b]pyridin-7-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-5-chloro-3-methyl-2-(oxan-2-yl)thieno[3,2-b]pyridin-7-amine;ethane?
The IUPAC name of N-benzyl-5-chloro-3-methyl-2-(oxan-2-yl)thieno[3,2-b]pyridin-7-amine;ethane (CID 170644363) is N-benzyl-5-chloro-3-methyl-2-(oxan-2-yl)thieno[3,2-b]pyridin-7-amine;ethane.
What is the SMILES notation for N-benzyl-5-chloro-3-methyl-2-(oxan-2-yl)thieno[3,2-b]pyridin-7-amine;ethane?
The canonical SMILES for N-benzyl-5-chloro-3-methyl-2-(oxan-2-yl)thieno[3,2-b]pyridin-7-amine;ethane is CC.Cc1c(C2CCCCO2)sc2c(NCc3ccccc3)cc(Cl)nc12.
What is the InChIKey of N-benzyl-5-chloro-3-methyl-2-(oxan-2-yl)thieno[3,2-b]pyridin-7-amine;ethane?
The InChIKey is CUWOJCYFQYMQSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21ClN2OS.C2H6/c1-13-18-20(25-19(13)16-9-5-6-10-24-16)15(11-17(21)23-18)22-12-14-7-3-2-4-8-14;1-2/h2-4,7-8,11,16H,5-6,9-10,12H2,1H3,(H,22,23);1-2H3.
What are the key properties of N-benzyl-5-chloro-3-methyl-2-(oxan-2-yl)thieno[3,2-b]pyridin-7-amine;ethane?
N-benzyl-5-chloro-3-methyl-2-(oxan-2-yl)thieno[3,2-b]pyridin-7-amine;ethane has a molecular weight of 402.99 g/mol, XLogP of 7.14, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-5-chloro-3-methyl-2-(oxan-2-yl)thieno[3,2-b]pyridin-7-amine;ethane is sourced from PubChem (CID 170644363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).