About N-benzyl-5-chloro-3-methylthieno[3,2-b]pyridin-7-amine;cyclohexanamine;ethane
N-benzyl-5-chloro-3-methylthieno[3,2-b]pyridin-7-amine;cyclohexanamine;ethane (PubChem CID 170644406) has the molecular formula C23H32ClN3S
and a molecular weight of 418.05 g/mol. Its IUPAC name is N-benzyl-5-chloro-3-methylthieno[3,2-b]pyridin-7-amine;cyclohexanamine;ethane.
Molecular Properties
| Compound Name | N-benzyl-5-chloro-3-methylthieno[3,2-b]pyridin-7-amine;cyclohexanamine;ethane |
| PubChem CID | 170644406 |
| Molecular Formula | C23H32ClN3S |
| Molecular Weight | 418.05 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | N-benzyl-5-chloro-3-methylthieno[3,2-b]pyridin-7-amine;cyclohexanamine;ethane |
| SMILES | CC.Cc1csc2c(NCc3ccccc3)cc(Cl)nc12.NC1CCCCC1 |
| InChI | InChI=1S/C15H13ClN2S.C6H13N.C2H6/c1-10-9-19-15-12(7-13(16)18-14(10)15)17-8-11-5-3-2-4-6-11;7-6-4-2-1-3-5-6;1-2/h2-7,9H,8H2,1H3,(H,17,18);6H,1-5,7H2;1-2H3 |
| InChIKey | HIDJVBVZDHKQQK-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.05 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-5-chloro-3-methylthieno[3,2-b]pyridin-7-amine;cyclohexanamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-5-chloro-3-methylthieno[3,2-b]pyridin-7-amine;cyclohexanamine;ethane?
The IUPAC name of N-benzyl-5-chloro-3-methylthieno[3,2-b]pyridin-7-amine;cyclohexanamine;ethane (CID 170644406) is N-benzyl-5-chloro-3-methylthieno[3,2-b]pyridin-7-amine;cyclohexanamine;ethane.
What is the SMILES notation for N-benzyl-5-chloro-3-methylthieno[3,2-b]pyridin-7-amine;cyclohexanamine;ethane?
The canonical SMILES for N-benzyl-5-chloro-3-methylthieno[3,2-b]pyridin-7-amine;cyclohexanamine;ethane is CC.Cc1csc2c(NCc3ccccc3)cc(Cl)nc12.NC1CCCCC1.
What is the InChIKey of N-benzyl-5-chloro-3-methylthieno[3,2-b]pyridin-7-amine;cyclohexanamine;ethane?
The InChIKey is HIDJVBVZDHKQQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClN2S.C6H13N.C2H6/c1-10-9-19-15-12(7-13(16)18-14(10)15)17-8-11-5-3-2-4-6-11;7-6-4-2-1-3-5-6;1-2/h2-7,9H,8H2,1H3,(H,17,18);6H,1-5,7H2;1-2H3.
What are the key properties of N-benzyl-5-chloro-3-methylthieno[3,2-b]pyridin-7-amine;cyclohexanamine;ethane?
N-benzyl-5-chloro-3-methylthieno[3,2-b]pyridin-7-amine;cyclohexanamine;ethane has a molecular weight of 418.05 g/mol, XLogP of 7.17, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-5-chloro-3-methylthieno[3,2-b]pyridin-7-amine;cyclohexanamine;ethane is sourced from PubChem (CID 170644406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).