C19H18BrClFN3OS — CID 170644407
2-[(2R,3R)-3-aminooxan-2-yl]-3-bromo-5-chloro-N-[(2-fluorophenyl)methyl]thieno[3,2-b]pyridin-7-amine (PubChem CID 170644407) has the molecular formula C19H18BrClFN3OS and a molecular weight of 470.80 g/mol. Its IUPAC name is 2-[(2R,3R)-3-aminooxan-2-yl]-3-bromo-5-chloro-N-[(2-fluorophenyl)methyl]thieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-[(2R,3R)-3-aminooxan-2-yl]-3-bromo-5-chloro-N-[(2-fluorophenyl)methyl]thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170644407 |
| Molecular Formula | C19H18BrClFN3OS |
| Molecular Weight | 470.80 g/mol |
| Exact Mass | 469.00 |
| IUPAC Name | 2-[(2R,3R)-3-aminooxan-2-yl]-3-bromo-5-chloro-N-[(2-fluorophenyl)methyl]thieno[3,2-b]pyridin-7-amine |
| SMILES | N[C@@H]1CCCO[C@H]1c1sc2c(NCc3ccccc3F)cc(Cl)nc2c1Br |
| InChI | InChI=1S/C19H18BrClFN3OS/c20-15-16-18(27-19(15)17-12(23)6-3-7-26-17)13(8-14(21)25-16)24-9-10-4-1-2-5-11(10)22/h1-2,4-5,8,12,17H,3,6-7,9,23H2,(H,24,25)/t12-,17-/m1/s1 |
| InChIKey | ABVFPAHKURBKLU-SJKOYZFVSA-N |
| XLogP | 5.64 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.80 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|