C19H19BrClN3S — CID 170644439
2-[(1R,2R)-2-aminocyclopentyl]-N-benzyl-3-bromo-5-chlorothieno[3,2-b]pyridin-7-amine (PubChem CID 170644439) has the molecular formula C19H19BrClN3S and a molecular weight of 436.81 g/mol. Its IUPAC name is 2-[(1R,2R)-2-aminocyclopentyl]-N-benzyl-3-bromo-5-chlorothieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-[(1R,2R)-2-aminocyclopentyl]-N-benzyl-3-bromo-5-chlorothieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170644439 |
| Molecular Formula | C19H19BrClN3S |
| Molecular Weight | 436.81 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | 2-[(1R,2R)-2-aminocyclopentyl]-N-benzyl-3-bromo-5-chlorothieno[3,2-b]pyridin-7-amine |
| SMILES | N[C@@H]1CCC[C@H]1c1sc2c(NCc3ccccc3)cc(Cl)nc2c1Br |
| InChI | InChI=1S/C19H19BrClN3S/c20-16-17-19(25-18(16)12-7-4-8-13(12)22)14(9-15(21)24-17)23-10-11-5-2-1-3-6-11/h1-3,5-6,9,12-13H,4,7-8,10,22H2,(H,23,24)/t12-,13-/m1/s1 |
| InChIKey | BOSGBGOWTARHNM-CHWSQXEVSA-N |
| XLogP | 5.92 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.81 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|