C17H16Cl2FN3OS — CID 170644466
2-[(1R,2S)-2-amino-1-fluorocyclopentyl]-3,5-dichloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine (PubChem CID 170644466) has the molecular formula C17H16Cl2FN3OS and a molecular weight of 400.31 g/mol. Its IUPAC name is 2-[(1R,2S)-2-amino-1-fluorocyclopentyl]-3,5-dichloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-[(1R,2S)-2-amino-1-fluorocyclopentyl]-3,5-dichloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170644466 |
| Molecular Formula | C17H16Cl2FN3OS |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 2-[(1R,2S)-2-amino-1-fluorocyclopentyl]-3,5-dichloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
| SMILES | N[C@H]1CCC[C@]1(F)c1sc2c(NCc3ccco3)cc(Cl)nc2c1Cl |
| InChI | InChI=1S/C17H16Cl2FN3OS/c18-12-7-10(22-8-9-3-2-6-24-9)15-14(23-12)13(19)16(25-15)17(20)5-1-4-11(17)21/h2-3,6-7,11H,1,4-5,8,21H2,(H,22,23)/t11-,17+/m0/s1 |
| InChIKey | OSSHYEIYNHIZSP-APPDUMDISA-N |
| XLogP | 5.48 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|