C19H21ClFN3OS — CID 170644563
2-[(1R,2S)-2-amino-1-fluorocyclohexyl]-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine (PubChem CID 170644563) has the molecular formula C19H21ClFN3OS and a molecular weight of 393.92 g/mol. Its IUPAC name is 2-[(1R,2S)-2-amino-1-fluorocyclohexyl]-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-[(1R,2S)-2-amino-1-fluorocyclohexyl]-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170644563 |
| Molecular Formula | C19H21ClFN3OS |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 2-[(1R,2S)-2-amino-1-fluorocyclohexyl]-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine |
| SMILES | Cc1c([C@@]2(F)CCCC[C@@H]2N)sc2c(NCc3ccco3)cc(Cl)nc12 |
| InChI | InChI=1S/C19H21ClFN3OS/c1-11-16-17(26-18(11)19(21)7-3-2-6-14(19)22)13(9-15(20)24-16)23-10-12-5-4-8-25-12/h4-5,8-9,14H,2-3,6-7,10,22H2,1H3,(H,23,24)/t14-,19+/m0/s1 |
| InChIKey | YEQLOYOKYCGBHI-IFXJQAMLSA-N |
| XLogP | 5.53 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|