C15H12O6 — CID 170646989
4-(3-carboxy-5-hydroxyphenyl)-2-methoxybenzoic acid (PubChem CID 170646989) has the molecular formula C15H12O6 and a molecular weight of 288.26 g/mol. Its IUPAC name is 4-(3-carboxy-5-hydroxyphenyl)-2-methoxybenzoic acid.
| Compound Name | 4-(3-carboxy-5-hydroxyphenyl)-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 170646989 |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 4-(3-carboxy-5-hydroxyphenyl)-2-methoxybenzoic acid |
| SMILES | COc1cc(-c2cc(O)cc(C(=O)O)c2)ccc1C(=O)O |
| InChI | InChI=1S/C15H12O6/c1-21-13-7-8(2-3-12(13)15(19)20)9-4-10(14(17)18)6-11(16)5-9/h2-7,16H,1H3,(H,17,18)(H,19,20) |
| InChIKey | VXRZCZYWZJWUEH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |